N-cycloheptyl-5-methyl-4-[methyl(phenyl)amino]thieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-5-methyl-4-[methyl(phenyl)amino]thieno[2,3-d]pyrimidine-6-carboxamide
N-cycloheptyl-5-methyl-4-[methyl(phenyl)amino]thieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | K895-0300 |
| Compound Name: | N-cycloheptyl-5-methyl-4-[methyl(phenyl)amino]thieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 394.54 |
| Molecular Formula: | C22 H26 N4 O S |
| Smiles: | Cc1c2c(ncnc2sc1C(NC1CCCCCC1)=O)N(C)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.2439 |
| logD: | 5.2383 |
| logSw: | -5.1024 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.729 |
| InChI Key: | CIJLYHUBHYRRCD-UHFFFAOYSA-N |