2-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide
Chemical Structure Depiction of
2-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide
2-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide
Compound characteristics
| Compound ID: | K904-0239 |
| Compound Name: | 2-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| Molecular Weight: | 356.81 |
| Molecular Formula: | C19 H17 Cl N2 O3 |
| Smiles: | C1CCc2c(C1)cccc2NC(CN1C(=O)Oc2cc(ccc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4947 |
| logD: | 4.4947 |
| logSw: | -4.7335 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.439 |
| InChI Key: | HQLLSPBVFGSXPL-UHFFFAOYSA-N |