ethyl 2-[2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamido]benzoate
Chemical Structure Depiction of
ethyl 2-[2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamido]benzoate
ethyl 2-[2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamido]benzoate
Compound characteristics
| Compound ID: | K905-0101 |
| Compound Name: | ethyl 2-[2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamido]benzoate |
| Molecular Weight: | 371.41 |
| Molecular Formula: | C18 H17 N3 O4 S |
| Smiles: | CCOC(c1ccccc1NC(CN1C=Nc2c(cc(C)s2)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7377 |
| logD: | 2.7277 |
| logSw: | -3.2227 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.446 |
| InChI Key: | KARREVVRMHNLEY-UHFFFAOYSA-N |