N-(2-methoxy-5-methylphenyl)-2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamide
Chemical Structure Depiction of
N-(2-methoxy-5-methylphenyl)-2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamide
N-(2-methoxy-5-methylphenyl)-2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamide
Compound characteristics
| Compound ID: | K905-0105 |
| Compound Name: | N-(2-methoxy-5-methylphenyl)-2-(6-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-yl)acetamide |
| Molecular Weight: | 343.4 |
| Molecular Formula: | C17 H17 N3 O3 S |
| Smiles: | Cc1ccc(c(c1)NC(CN1C=Nc2c(cc(C)s2)C1=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.3064 |
| logD: | 2.3064 |
| logSw: | -3.0897 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.323 |
| InChI Key: | YNXSYDYUULOSEZ-UHFFFAOYSA-N |