1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide
1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | K906-0630 |
| Compound Name: | 1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 552.46 |
| Molecular Formula: | C24 H27 Br F N3 O4 S |
| Smiles: | CCC(N1CCc2cc(c(cc12)S(N1CCC(CC1)C(NCc1ccc(cc1)F)=O)(=O)=O)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.1519 |
| logD: | 3.1519 |
| logSw: | -3.4894 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.786 |
| InChI Key: | SREWDIHSBCPGBQ-UHFFFAOYSA-N |