ethyl 2-methyl-1-(3-{[2-(4-methylphenyl)ethyl]amino}-3-oxopropyl)-5-phenyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 2-methyl-1-(3-{[2-(4-methylphenyl)ethyl]amino}-3-oxopropyl)-5-phenyl-1H-pyrrole-3-carboxylate
ethyl 2-methyl-1-(3-{[2-(4-methylphenyl)ethyl]amino}-3-oxopropyl)-5-phenyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | K906-1898 |
| Compound Name: | ethyl 2-methyl-1-(3-{[2-(4-methylphenyl)ethyl]amino}-3-oxopropyl)-5-phenyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 418.54 |
| Molecular Formula: | C26 H30 N2 O3 |
| Smiles: | CCOC(c1cc(c2ccccc2)n(CCC(NCCc2ccc(C)cc2)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7708 |
| logD: | 4.7708 |
| logSw: | -4.3844 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.963 |
| InChI Key: | JCALSCYEXXPUKK-UHFFFAOYSA-N |