ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-5-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-5-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate
ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-5-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | K906-3145 |
| Compound Name: | ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-5-(4-fluorophenyl)-2-methyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 454.5 |
| Molecular Formula: | C25 H27 F N2 O5 |
| Smiles: | CCOC(c1cc(c2ccc(cc2)F)n(CCC(Nc2cc(cc(c2)OC)OC)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1457 |
| logD: | 5.145 |
| logSw: | -5.0086 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.887 |
| InChI Key: | DJDGVMZCZBWZDM-UHFFFAOYSA-N |