2-[3-acetyl-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-1-yl]-N-(4-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-[3-acetyl-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-1-yl]-N-(4-methoxyphenyl)acetamide
2-[3-acetyl-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-1-yl]-N-(4-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | K906-3147 |
| Compound Name: | 2-[3-acetyl-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-1-yl]-N-(4-methoxyphenyl)acetamide |
| Molecular Weight: | 380.42 |
| Molecular Formula: | C22 H21 F N2 O3 |
| Smiles: | CC(c1cc(c2ccc(cc2)F)n(CC(Nc2ccc(cc2)OC)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3107 |
| logD: | 4.3107 |
| logSw: | -4.3396 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.438 |
| InChI Key: | SPTDADRHHBGEDP-UHFFFAOYSA-N |