1-{5-[2-(furan-2-yl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-4-carboxamide
Chemical Structure Depiction of
1-{5-[2-(furan-2-yl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-4-carboxamide
1-{5-[2-(furan-2-yl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-4-carboxamide
Compound characteristics
| Compound ID: | K906-3680 |
| Compound Name: | 1-{5-[2-(furan-2-yl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-4-carboxamide |
| Molecular Weight: | 379.43 |
| Molecular Formula: | C17 H21 N3 O5 S |
| Smiles: | Cc1c(c(/C=C/c2ccco2)on1)S(N1CCC(CC1)C(NC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.9324 |
| logD: | 0.9324 |
| logSw: | -2.242 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.049 |
| InChI Key: | RUOWHVNEGZYBNI-UHFFFAOYSA-N |