(1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(piperidin-1-yl)methanone
Chemical Structure Depiction of
(1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(piperidin-1-yl)methanone
(1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | K906-3681 |
| Compound Name: | (1-{3-methyl-5-[2-(thiophen-2-yl)ethenyl]-1,2-oxazole-4-sulfonyl}piperidin-4-yl)(piperidin-1-yl)methanone |
| Molecular Weight: | 449.59 |
| Molecular Formula: | C21 H27 N3 O4 S2 |
| Smiles: | Cc1c(c(/C=C/c2cccs2)on1)S(N1CCC(CC1)C(N1CCCCC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6139 |
| logD: | 2.6139 |
| logSw: | -2.7061 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 71.132 |
| InChI Key: | CKUFYNOKLKFRGH-UHFFFAOYSA-N |