1,4,7-trimethyl-N-(4-methylphenyl)-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide
Chemical Structure Depiction of
1,4,7-trimethyl-N-(4-methylphenyl)-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide
1,4,7-trimethyl-N-(4-methylphenyl)-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide
Compound characteristics
| Compound ID: | K906-4502 |
| Compound Name: | 1,4,7-trimethyl-N-(4-methylphenyl)-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide |
| Molecular Weight: | 373.43 |
| Molecular Formula: | C18 H19 N3 O4 S |
| Smiles: | Cc1ccc(cc1)NS(c1cc2c(cc1C)N(C)C(C(N2C)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0646 |
| logD: | 2.0425 |
| logSw: | -2.9124 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.247 |
| InChI Key: | QTQREGWLNAXBQU-UHFFFAOYSA-N |