5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)thiophene-2-sulfonamide
5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | K906-4702 |
| Compound Name: | 5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)thiophene-2-sulfonamide |
| Molecular Weight: | 417.44 |
| Molecular Formula: | C18 H12 F N3 O4 S2 |
| Smiles: | C(c1ccc(s1)S(Nc1ccc(cc1)F)(=O)=O)N1C(c2cccnc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0981 |
| logD: | 1.9574 |
| logSw: | -3.1573 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.068 |
| InChI Key: | ZIBLDFPDZGGYNZ-UHFFFAOYSA-N |