N-(3,4-dichlorophenyl)-2-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-(3,4-dichlorophenyl)-2-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzene-1-sulfonamide
N-(3,4-dichlorophenyl)-2-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | K906-4931 |
| Compound Name: | N-(3,4-dichlorophenyl)-2-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzene-1-sulfonamide |
| Molecular Weight: | 480.3 |
| Molecular Formula: | C20 H12 Cl2 F N3 O4 S |
| Smiles: | C(c1ccc(cc1S(Nc1ccc(c(c1)[Cl])[Cl])(=O)=O)F)N1C(c2cccnc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.537 |
| logD: | 0.5674 |
| logSw: | -3.9481 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.05 |
| InChI Key: | HKCMHCJWOBFEIP-UHFFFAOYSA-N |