N-(4-bromo-2-methylphenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
N-(4-bromo-2-methylphenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide
N-(4-bromo-2-methylphenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | K913-0037 |
| Compound Name: | N-(4-bromo-2-methylphenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 552.49 |
| Molecular Formula: | C26 H26 Br N5 O2 S |
| Smiles: | Cc1cc(ccc1NC(c1c(C)c2c(ncnc2s1)N1CCN(CC1)c1ccccc1OC)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 6.2251 |
| logD: | 6.1995 |
| logSw: | -5.745 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.522 |
| InChI Key: | AAGRZUZWYQCHLS-UHFFFAOYSA-N |