Nalpha-(4-chlorobenzene-1-sulfonyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]phenylalaninamide
Chemical Structure Depiction of
Nalpha-(4-chlorobenzene-1-sulfonyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]phenylalaninamide
Nalpha-(4-chlorobenzene-1-sulfonyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]phenylalaninamide
Compound characteristics
| Compound ID: | K938-0195 |
| Compound Name: | Nalpha-(4-chlorobenzene-1-sulfonyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]phenylalaninamide |
| Molecular Weight: | 503.02 |
| Molecular Formula: | C25 H27 Cl N2 O5 S |
| Smiles: | COc1ccc(CCNC(C(Cc2ccccc2)NS(c2ccc(cc2)[Cl])(=O)=O)=O)cc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8579 |
| logD: | 3.8578 |
| logSw: | -4.3404 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.356 |
| InChI Key: | UFIUSKGSSHFIPT-QFIPXVFZSA-N |