N-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-1-(4-methoxyphenyl)-3-oxopropyl]-4-fluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-1-(4-methoxyphenyl)-3-oxopropyl]-4-fluorobenzene-1-sulfonamide
N-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-1-(4-methoxyphenyl)-3-oxopropyl]-4-fluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | K938-2043 |
| Compound Name: | N-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-1-(4-methoxyphenyl)-3-oxopropyl]-4-fluorobenzene-1-sulfonamide |
| Molecular Weight: | 478.54 |
| Molecular Formula: | C23 H27 F N2 O6 S |
| Smiles: | COc1ccc(cc1)C(CC(N1CCC2(CC1)OCCO2)=O)NS(c1ccc(cc1)F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5732 |
| logD: | 2.5731 |
| logSw: | -2.9569 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.942 |
| InChI Key: | GICQAUKQSUEMNL-NRFANRHFSA-N |