3-(4-methoxyphenyl)-N-(3-methoxypropyl)-3-[(4-methylbenzene-1-sulfonyl)amino]propanamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-N-(3-methoxypropyl)-3-[(4-methylbenzene-1-sulfonyl)amino]propanamide
3-(4-methoxyphenyl)-N-(3-methoxypropyl)-3-[(4-methylbenzene-1-sulfonyl)amino]propanamide
Compound characteristics
| Compound ID: | K938-2249 |
| Compound Name: | 3-(4-methoxyphenyl)-N-(3-methoxypropyl)-3-[(4-methylbenzene-1-sulfonyl)amino]propanamide |
| Molecular Weight: | 420.53 |
| Molecular Formula: | C21 H28 N2 O5 S |
| Smiles: | Cc1ccc(cc1)S(NC(CC(NCCCOC)=O)c1ccc(cc1)OC)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.956 |
| logD: | 2.9559 |
| logSw: | -3.442 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.04 |
| InChI Key: | GYXLWJGLSBUARQ-FQEVSTJZSA-N |