2-[4-(4-bromobenzene-1-sulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-[4-(4-bromobenzene-1-sulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide
2-[4-(4-bromobenzene-1-sulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | K940-0163 |
| Compound Name: | 2-[4-(4-bromobenzene-1-sulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
| Molecular Weight: | 502.81 |
| Molecular Formula: | C19 H21 Br Cl N3 O4 S |
| Smiles: | COc1ccc(cc1[Cl])NC(CN1CCN(CC1)S(c1ccc(cc1)[Br])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0961 |
| logD: | 4.0956 |
| logSw: | -4.3716 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.27 |
| InChI Key: | MJUZQRONJYLJTF-UHFFFAOYSA-N |