1-(4-methoxybenzene-1-sulfonyl)-4-[(2-methylphenyl)methyl]piperazine
Chemical Structure Depiction of
1-(4-methoxybenzene-1-sulfonyl)-4-[(2-methylphenyl)methyl]piperazine
1-(4-methoxybenzene-1-sulfonyl)-4-[(2-methylphenyl)methyl]piperazine
Compound characteristics
| Compound ID: | K940-0240 |
| Compound Name: | 1-(4-methoxybenzene-1-sulfonyl)-4-[(2-methylphenyl)methyl]piperazine |
| Molecular Weight: | 360.47 |
| Molecular Formula: | C19 H24 N2 O3 S |
| Smiles: | Cc1ccccc1CN1CCN(CC1)S(c1ccc(cc1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4448 |
| logD: | 3.4406 |
| logSw: | -3.5054 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 43.034 |
| InChI Key: | QNPZSWGTZUKDNJ-UHFFFAOYSA-N |