1-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]piperazine
Chemical Structure Depiction of
1-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]piperazine
1-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]piperazine
Compound characteristics
| Compound ID: | K940-1113 |
| Compound Name: | 1-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]piperazine |
| Molecular Weight: | 304.79 |
| Molecular Formula: | C17 H18 Cl F N2 |
| Smiles: | C1CN(CCN1Cc1ccccc1F)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.273 |
| logD: | 4.2271 |
| logSw: | -4.5759 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 7.2313 |
| InChI Key: | XCNNYFCGHTYRNS-UHFFFAOYSA-N |