1-[4-(2-fluorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one
Chemical Structure Depiction of
1-[4-(2-fluorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one
1-[4-(2-fluorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one
Compound characteristics
| Compound ID: | K940-1490 |
| Compound Name: | 1-[4-(2-fluorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| Molecular Weight: | 310.37 |
| Molecular Formula: | C19 H19 F N2 O |
| Smiles: | C1CN(CCN1C(/C=C/c1ccccc1)=O)c1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 3.6167 |
| logD: | 3.6166 |
| logSw: | -3.698 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 19.3187 |
| InChI Key: | PDMJWRTVNYLVFW-UHFFFAOYSA-N |