N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]acetamide
Chemical Structure Depiction of
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]acetamide
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]acetamide
Compound characteristics
| Compound ID: | K940-1562 |
| Compound Name: | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]acetamide |
| Molecular Weight: | 485.94 |
| Molecular Formula: | C26 H23 Cl F3 N3 O |
| Smiles: | C1CN(CCN1CC(Nc1cc(ccc1[Cl])C(F)(F)F)=O)C1c2ccccc2c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 6.0295 |
| logD: | 5.2107 |
| logSw: | -6.1765 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.2696 |
| InChI Key: | HCYVGLMMDIKAPS-UHFFFAOYSA-N |