N-(2-fluorophenyl)-3-(2-sulfanylidene-1,3-benzoxazol-3(2H)-yl)propanamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-3-(2-sulfanylidene-1,3-benzoxazol-3(2H)-yl)propanamide
N-(2-fluorophenyl)-3-(2-sulfanylidene-1,3-benzoxazol-3(2H)-yl)propanamide
Compound characteristics
| Compound ID: | K953-0380 |
| Compound Name: | N-(2-fluorophenyl)-3-(2-sulfanylidene-1,3-benzoxazol-3(2H)-yl)propanamide |
| Molecular Weight: | 316.35 |
| Molecular Formula: | C16 H13 F N2 O2 S |
| Smiles: | C(CN1C(Oc2ccccc12)=S)C(Nc1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0817 |
| logD: | 3.0807 |
| logSw: | -3.5607 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.305 |
| InChI Key: | ROIFPOHUISHMIH-UHFFFAOYSA-N |