N-(2-bromo-4-methylphenyl)-2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)acetamide
Chemical Structure Depiction of
N-(2-bromo-4-methylphenyl)-2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)acetamide
N-(2-bromo-4-methylphenyl)-2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)acetamide
Compound characteristics
| Compound ID: | K978-0100 |
| Compound Name: | N-(2-bromo-4-methylphenyl)-2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)acetamide |
| Molecular Weight: | 389.25 |
| Molecular Formula: | C18 H17 Br N2 O3 |
| Smiles: | Cc1ccc(c(c1)[Br])NC(CN1C(C2C3CC(C=C3)C2C1=O)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.2264 |
| logD: | 2.2264 |
| logSw: | -2.8146 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.787 |
| InChI Key: | XVTGDKQANODWRO-UHFFFAOYSA-N |