3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-phenylethyl)propanamide
Chemical Structure Depiction of
3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-phenylethyl)propanamide
3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-phenylethyl)propanamide
Compound characteristics
| Compound ID: | K978-0278 |
| Compound Name: | 3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-phenylethyl)propanamide |
| Molecular Weight: | 338.4 |
| Molecular Formula: | C20 H22 N2 O3 |
| Smiles: | C(CN1C(C2C3CC(C=C3)C2C1=O)=O)C(NCCc1ccccc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 0.9593 |
| logD: | 0.9593 |
| logSw: | -1.7222 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.627 |
| InChI Key: | HHANHDMIUFEDEW-UHFFFAOYSA-N |