3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-fluorophenyl)propanamide
Chemical Structure Depiction of
3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-fluorophenyl)propanamide
3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-fluorophenyl)propanamide
Compound characteristics
| Compound ID: | K978-0317 |
| Compound Name: | 3-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl)-N-(2-fluorophenyl)propanamide |
| Molecular Weight: | 328.34 |
| Molecular Formula: | C18 H17 F N2 O3 |
| Smiles: | C(CN1C(C2C3CC(C=C3)C2C1=O)=O)C(Nc1ccccc1F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 1.2644 |
| logD: | 1.2639 |
| logSw: | -2.0479 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.766 |
| InChI Key: | UKTZPUANWLOTRE-UHFFFAOYSA-N |