3-(4-chlorobenzene-1-sulfonyl)-N-[2-(4-chlorophenyl)ethyl]propanamide
Chemical Structure Depiction of
3-(4-chlorobenzene-1-sulfonyl)-N-[2-(4-chlorophenyl)ethyl]propanamide
3-(4-chlorobenzene-1-sulfonyl)-N-[2-(4-chlorophenyl)ethyl]propanamide
Compound characteristics
| Compound ID: | K978-1070 |
| Compound Name: | 3-(4-chlorobenzene-1-sulfonyl)-N-[2-(4-chlorophenyl)ethyl]propanamide |
| Molecular Weight: | 386.29 |
| Molecular Formula: | C17 H17 Cl2 N O3 S |
| Smiles: | C(CS(c1ccc(cc1)[Cl])(=O)=O)C(NCCc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.9247 |
| logD: | 2.9247 |
| logSw: | -3.4168 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.316 |
| InChI Key: | ZRNSIBFCTOFIEU-UHFFFAOYSA-N |