3-(2-methoxyphenyl)-4-oxo-N-[4-(propan-2-yl)phenyl]-3,4-dihydrophthalazine-1-carboxamide
Chemical Structure Depiction of
3-(2-methoxyphenyl)-4-oxo-N-[4-(propan-2-yl)phenyl]-3,4-dihydrophthalazine-1-carboxamide
3-(2-methoxyphenyl)-4-oxo-N-[4-(propan-2-yl)phenyl]-3,4-dihydrophthalazine-1-carboxamide
Compound characteristics
| Compound ID: | K979-0701 |
| Compound Name: | 3-(2-methoxyphenyl)-4-oxo-N-[4-(propan-2-yl)phenyl]-3,4-dihydrophthalazine-1-carboxamide |
| Molecular Weight: | 413.48 |
| Molecular Formula: | C25 H23 N3 O3 |
| Smiles: | CC(C)c1ccc(cc1)NC(C1c2ccccc2C(N(c2ccccc2OC)N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8965 |
| logD: | 4.8963 |
| logSw: | -4.5121 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.468 |
| InChI Key: | NSKRTRGCBXDYJI-UHFFFAOYSA-N |