N-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide
N-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide
Compound characteristics
| Compound ID: | K979-0723 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide |
| Molecular Weight: | 445.47 |
| Molecular Formula: | C25 H23 N3 O5 |
| Smiles: | CCOc1ccc(cc1)N1C(c2ccccc2C(C(Nc2ccc(cc2OC)OC)=O)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0405 |
| logD: | 4.0306 |
| logSw: | -4.1614 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.739 |
| InChI Key: | MBOFCRNGUXUHSH-UHFFFAOYSA-N |