N-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}-2-phenylacetamide
Chemical Structure Depiction of
N-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}-2-phenylacetamide
N-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}-2-phenylacetamide
Compound characteristics
| Compound ID: | L056-2197 |
| Compound Name: | N-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}-2-phenylacetamide |
| Molecular Weight: | 400.48 |
| Molecular Formula: | C25 H24 N2 O3 |
| Smiles: | COc1ccc(cc1)C(N1CCc2ccc(CNC(Cc3ccccc3)=O)cc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5574 |
| logD: | 3.5574 |
| logSw: | -3.8086 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.661 |
| InChI Key: | RLKIYVIWFSBQJJ-UHFFFAOYSA-N |