N-[(1-benzoyl-2-methyl-2,3-dihydro-1H-indol-6-yl)methyl]-N'-(3-methylphenyl)urea
Chemical Structure Depiction of
N-[(1-benzoyl-2-methyl-2,3-dihydro-1H-indol-6-yl)methyl]-N'-(3-methylphenyl)urea
N-[(1-benzoyl-2-methyl-2,3-dihydro-1H-indol-6-yl)methyl]-N'-(3-methylphenyl)urea
Compound characteristics
| Compound ID: | L057-0675 |
| Compound Name: | N-[(1-benzoyl-2-methyl-2,3-dihydro-1H-indol-6-yl)methyl]-N'-(3-methylphenyl)urea |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C25 H25 N3 O2 |
| Smiles: | CC1Cc2ccc(CNC(Nc3cccc(C)c3)=O)cc2N1C(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4235 |
| logD: | 4.4235 |
| logSw: | -4.3219 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.481 |
| InChI Key: | YDABWFOMWVSCAU-GOSISDBHSA-N |