N-(3-acetylphenyl)-N'-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}urea
Chemical Structure Depiction of
N-(3-acetylphenyl)-N'-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}urea
N-(3-acetylphenyl)-N'-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}urea
Compound characteristics
| Compound ID: | L057-1513 |
| Compound Name: | N-(3-acetylphenyl)-N'-{[1-(4-methoxybenzoyl)-2,3-dihydro-1H-indol-6-yl]methyl}urea |
| Molecular Weight: | 443.5 |
| Molecular Formula: | C26 H25 N3 O4 |
| Smiles: | CC(c1cccc(c1)NC(NCc1ccc2CCN(C(c3ccc(cc3)OC)=O)c2c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6141 |
| logD: | 3.6141 |
| logSw: | -3.874 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.913 |
| InChI Key: | GAHJGHNDQHTMIA-UHFFFAOYSA-N |