N-[(4-ethylphenyl)methyl]-3-(4-methyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)propanamide
Chemical Structure Depiction of
N-[(4-ethylphenyl)methyl]-3-(4-methyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)propanamide
N-[(4-ethylphenyl)methyl]-3-(4-methyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)propanamide
Compound characteristics
| Compound ID: | L058-0404 |
| Compound Name: | N-[(4-ethylphenyl)methyl]-3-(4-methyl-2,3-dioxo-3,4-dihydroquinoxalin-1(2H)-yl)propanamide |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C21 H23 N3 O3 |
| Smiles: | CCc1ccc(CNC(CCN2C(C(N(C)c3ccccc23)=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.305 |
| logD: | 2.305 |
| logSw: | -2.5666 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.01 |
| InChI Key: | VYMLMDKIKQXGLM-UHFFFAOYSA-N |