N-(3-chlorophenyl)-5-[(2-ethoxybenzamido)methyl]-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-5-[(2-ethoxybenzamido)methyl]-1,3,4-thiadiazole-2-carboxamide
N-(3-chlorophenyl)-5-[(2-ethoxybenzamido)methyl]-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L061-0313 |
| Compound Name: | N-(3-chlorophenyl)-5-[(2-ethoxybenzamido)methyl]-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 416.88 |
| Molecular Formula: | C19 H17 Cl N4 O3 S |
| Smiles: | CCOc1ccccc1C(NCc1nnc(C(Nc2cccc(c2)[Cl])=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9852 |
| logD: | 3.982 |
| logSw: | -4.3411 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.952 |
| InChI Key: | TWBRANPJVMGOEV-UHFFFAOYSA-N |