N-(3-fluorophenyl)-5-[(3-methylbutanamido)methyl]-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-5-[(3-methylbutanamido)methyl]-1,3,4-thiadiazole-2-carboxamide
N-(3-fluorophenyl)-5-[(3-methylbutanamido)methyl]-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L061-0410 |
| Compound Name: | N-(3-fluorophenyl)-5-[(3-methylbutanamido)methyl]-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 336.39 |
| Molecular Formula: | C15 H17 F N4 O2 S |
| Smiles: | CC(C)CC(NCc1nnc(C(Nc2cccc(c2)F)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5564 |
| logD: | 2.5531 |
| logSw: | -3.001 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.8 |
| InChI Key: | YBJZXDMAMQORJE-UHFFFAOYSA-N |