N-(4-methoxyphenyl)-5-{[(3-methoxyphenyl)carbamamido]methyl}-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
N-(4-methoxyphenyl)-5-{[(3-methoxyphenyl)carbamamido]methyl}-1,3,4-thiadiazole-2-carboxamide
N-(4-methoxyphenyl)-5-{[(3-methoxyphenyl)carbamamido]methyl}-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L062-0382 |
| Compound Name: | N-(4-methoxyphenyl)-5-{[(3-methoxyphenyl)carbamamido]methyl}-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 413.45 |
| Molecular Formula: | C19 H19 N5 O4 S |
| Smiles: | COc1ccc(cc1)NC(c1nnc(CNC(Nc2cccc(c2)OC)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.905 |
| logD: | 2.9049 |
| logSw: | -3.6254 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 96.042 |
| InChI Key: | HXFJFOJFNVITTN-UHFFFAOYSA-N |