5-[(cyclohexylcarbamamido)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
5-[(cyclohexylcarbamamido)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide
5-[(cyclohexylcarbamamido)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L062-0551 |
| Compound Name: | 5-[(cyclohexylcarbamamido)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 359.45 |
| Molecular Formula: | C17 H21 N5 O2 S |
| Smiles: | C1CCC(CC1)NC(NCc1nnc(C(Nc2ccccc2)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5055 |
| logD: | 2.5055 |
| logSw: | -2.8113 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 82.002 |
| InChI Key: | TUBKBCYYZNEFSA-UHFFFAOYSA-N |