5-{1-[(4-fluorophenoxy)acetyl]piperidin-3-yl}-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
5-{1-[(4-fluorophenoxy)acetyl]piperidin-3-yl}-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide
5-{1-[(4-fluorophenoxy)acetyl]piperidin-3-yl}-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L064-0638 |
| Compound Name: | 5-{1-[(4-fluorophenoxy)acetyl]piperidin-3-yl}-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 454.52 |
| Molecular Formula: | C23 H23 F N4 O3 S |
| Smiles: | Cc1ccc(cc1)NC(c1nnc(C2CCCN(C2)C(COc2ccc(cc2)F)=O)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4152 |
| logD: | 3.4151 |
| logSw: | -3.5823 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.116 |
| InChI Key: | BXTAIMKMWFQFNK-INIZCTEOSA-N |