N-tert-butyl-3-{5-[(4-chlorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl}piperidine-1-carboxamide
Chemical Structure Depiction of
N-tert-butyl-3-{5-[(4-chlorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl}piperidine-1-carboxamide
N-tert-butyl-3-{5-[(4-chlorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl}piperidine-1-carboxamide
Compound characteristics
| Compound ID: | L065-0212 |
| Compound Name: | N-tert-butyl-3-{5-[(4-chlorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl}piperidine-1-carboxamide |
| Molecular Weight: | 421.95 |
| Molecular Formula: | C19 H24 Cl N5 O2 S |
| Smiles: | CC(C)(C)NC(N1CCCC(C1)c1nnc(C(Nc2ccc(cc2)[Cl])=O)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8091 |
| logD: | 3.8064 |
| logSw: | -4.3994 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.382 |
| InChI Key: | BWSNBTSYXZDHKL-LBPRGKRZSA-N |