N-[3-(methylsulfanyl)phenyl]-3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carboxamide
Chemical Structure Depiction of
N-[3-(methylsulfanyl)phenyl]-3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carboxamide
N-[3-(methylsulfanyl)phenyl]-3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carboxamide
Compound characteristics
| Compound ID: | L065-0742 |
| Compound Name: | N-[3-(methylsulfanyl)phenyl]-3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]piperidine-1-carboxamide |
| Molecular Weight: | 453.58 |
| Molecular Formula: | C22 H23 N5 O2 S2 |
| Smiles: | CSc1cccc(c1)NC(N1CCCC(C1)c1nnc(C(Nc2ccccc2)=O)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8174 |
| logD: | 3.8173 |
| logSw: | -3.9329 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.965 |
| InChI Key: | RCWRGBSFYZNISI-HNNXBMFYSA-N |