ethyl 6-bromo-7-[(3-methoxyphenyl)methoxy]-2-propanamido-1-benzothiophene-3-carboxylate
					Chemical Structure Depiction of
ethyl 6-bromo-7-[(3-methoxyphenyl)methoxy]-2-propanamido-1-benzothiophene-3-carboxylate
			ethyl 6-bromo-7-[(3-methoxyphenyl)methoxy]-2-propanamido-1-benzothiophene-3-carboxylate
Compound characteristics
| Compound ID: | L068-0200 | 
| Compound Name: | ethyl 6-bromo-7-[(3-methoxyphenyl)methoxy]-2-propanamido-1-benzothiophene-3-carboxylate | 
| Molecular Weight: | 492.39 | 
| Molecular Formula: | C22 H22 Br N O5 S | 
| Smiles: | CCC(Nc1c(C(=O)OCC)c2ccc(c(c2s1)OCc1cccc(c1)OC)[Br])=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.5527 | 
| logD: | 5.5342 | 
| logSw: | -5.675 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 58.609 | 
| InChI Key: | PNMKQWHBUGFMNH-UHFFFAOYSA-N | 
 
				 
				