N-(2,4-difluorophenyl)-5-{1-[(4-fluorophenoxy)acetyl]piperidin-4-yl}-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-5-{1-[(4-fluorophenoxy)acetyl]piperidin-4-yl}-1,3,4-thiadiazole-2-carboxamide
N-(2,4-difluorophenyl)-5-{1-[(4-fluorophenoxy)acetyl]piperidin-4-yl}-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L076-1243 |
| Compound Name: | N-(2,4-difluorophenyl)-5-{1-[(4-fluorophenoxy)acetyl]piperidin-4-yl}-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 476.48 |
| Molecular Formula: | C22 H19 F3 N4 O3 S |
| Smiles: | C1CN(CCC1c1nnc(C(Nc2ccc(cc2F)F)=O)s1)C(COc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0384 |
| logD: | 2.8682 |
| logSw: | -3.3724 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.484 |
| InChI Key: | QXJMDBIOBBUHRR-UHFFFAOYSA-N |