N-{N'-(3-methoxyphenyl)-N-[(oxolan-2-yl)methyl]carbamimidoyl}benzamide
Chemical Structure Depiction of
N-{N'-(3-methoxyphenyl)-N-[(oxolan-2-yl)methyl]carbamimidoyl}benzamide
N-{N'-(3-methoxyphenyl)-N-[(oxolan-2-yl)methyl]carbamimidoyl}benzamide
Compound characteristics
| Compound ID: | L088-0277 |
| Compound Name: | N-{N'-(3-methoxyphenyl)-N-[(oxolan-2-yl)methyl]carbamimidoyl}benzamide |
| Molecular Weight: | 353.42 |
| Molecular Formula: | C20 H23 N3 O3 |
| Smiles: | COc1cccc(c1)/N=C(\NCC1CCCO1)NC(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.951 |
| logD: | 2.932 |
| logSw: | -3.4844 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.049 |
| InChI Key: | WCDDJOKKLOLHCM-GOSISDBHSA-N |