N-cyclopropyl-2-[1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
N-cyclopropyl-2-[1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazole-5-carboxamide
N-cyclopropyl-2-[1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | L102-0206 |
| Compound Name: | N-cyclopropyl-2-[1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 369.44 |
| Molecular Formula: | C18 H19 N5 O2 S |
| Smiles: | Cc1c(C(NC2CC2)=O)sc(c2c(C)n(c3ccc(cc3)OC)nn2)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.747 |
| logD: | 2.747 |
| logSw: | -3.2653 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.406 |
| InChI Key: | JICVSIQDIGAMCD-UHFFFAOYSA-N |