{2-[1-(3-chlorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazol-5-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{2-[1-(3-chlorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazol-5-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone
{2-[1-(3-chlorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazol-5-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | L102-1033 |
| Compound Name: | {2-[1-(3-chlorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-1,3-thiazol-5-yl}[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 496.99 |
| Molecular Formula: | C24 H22 Cl F N6 O S |
| Smiles: | Cc1c(C(N2CCN(CC2)c2ccccc2F)=O)sc(c2c(C)n(c3cccc(c3)[Cl])nn2)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.8276 |
| logD: | 4.8276 |
| logSw: | -4.8664 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 57 |
| InChI Key: | MIKCEGXHQJBKHX-UHFFFAOYSA-N |