2-[1-(3,4-dimethylphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-N-(2-phenylpropyl)-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
2-[1-(3,4-dimethylphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-N-(2-phenylpropyl)-1,3-thiazole-5-carboxamide
2-[1-(3,4-dimethylphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-N-(2-phenylpropyl)-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | L102-1493 |
| Compound Name: | 2-[1-(3,4-dimethylphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-4-methyl-N-(2-phenylpropyl)-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 445.59 |
| Molecular Formula: | C25 H27 N5 O S |
| Smiles: | CC(CNC(c1c(C)nc(c2c(C)n(c3ccc(C)c(C)c3)nn2)s1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.8597 |
| logD: | 5.8597 |
| logSw: | -5.442 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.806 |
| InChI Key: | JSSALBPOYAEVID-KRWDZBQOSA-N |