5-[(benzenesulfonyl)methyl]-3-[4-(benzyloxy)phenyl]-1,2,4-oxadiazole
Chemical Structure Depiction of
5-[(benzenesulfonyl)methyl]-3-[4-(benzyloxy)phenyl]-1,2,4-oxadiazole
5-[(benzenesulfonyl)methyl]-3-[4-(benzyloxy)phenyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | L106-0469 |
| Compound Name: | 5-[(benzenesulfonyl)methyl]-3-[4-(benzyloxy)phenyl]-1,2,4-oxadiazole |
| Molecular Weight: | 406.46 |
| Molecular Formula: | C22 H18 N2 O4 S |
| Smiles: | C(c1ccccc1)Oc1ccc(cc1)c1nc(CS(c2ccccc2)(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.53 |
| logD: | 4.53 |
| logSw: | -4.7233 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 67.574 |
| InChI Key: | DHNRPNKDEAAUDD-UHFFFAOYSA-N |