3-[(2-chlorophenyl)methyl]-7-(2-methylphenyl)thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
3-[(2-chlorophenyl)methyl]-7-(2-methylphenyl)thieno[3,2-d]pyrimidin-4(3H)-one
3-[(2-chlorophenyl)methyl]-7-(2-methylphenyl)thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | L115-0079 |
| Compound Name: | 3-[(2-chlorophenyl)methyl]-7-(2-methylphenyl)thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 366.87 |
| Molecular Formula: | C20 H15 Cl N2 O S |
| Smiles: | Cc1ccccc1c1csc2C(N(Cc3ccccc3[Cl])C=Nc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8974 |
| logD: | 4.8974 |
| logSw: | -4.8695 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.8336 |
| InChI Key: | YZZNWSJKLDICDY-UHFFFAOYSA-N |