ethyl [7-(2,5-dimethylphenyl)-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]acetate
Chemical Structure Depiction of
ethyl [7-(2,5-dimethylphenyl)-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]acetate
ethyl [7-(2,5-dimethylphenyl)-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]acetate
Compound characteristics
| Compound ID: | L115-0197 |
| Compound Name: | ethyl [7-(2,5-dimethylphenyl)-4-oxothieno[3,2-d]pyrimidin-3(4H)-yl]acetate |
| Molecular Weight: | 342.41 |
| Molecular Formula: | C18 H18 N2 O3 S |
| Smiles: | CCOC(CN1C=Nc2c(csc2C1=O)c1cc(C)ccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4237 |
| logD: | 3.4237 |
| logSw: | -3.6045 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.264 |
| InChI Key: | JYHUMEBRYZAITL-UHFFFAOYSA-N |