N-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-5-(1H-pyrrol-1-yl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-5-(1H-pyrrol-1-yl)-1H-1,2,3-triazole-4-carboxamide
N-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-5-(1H-pyrrol-1-yl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L116-1877 |
| Compound Name: | N-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-5-(1H-pyrrol-1-yl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 412.28 |
| Molecular Formula: | C20 H15 Cl2 N5 O |
| Smiles: | C(c1ccc(cc1)[Cl])n1c(c(C(Nc2ccc(cc2)[Cl])=O)nn1)n1cccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.959 |
| logD: | 4.9589 |
| logSw: | -5.1664 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.828 |
| InChI Key: | ZTMGQUREMFEMTA-UHFFFAOYSA-N |